C20H26N4O3Si — CID 174064367
3-amino-N-[2-(4-dimethylsilylanilino)-1-(4-methoxyphenyl)-2-oxoethyl]-3-iminopropanamide (PubChem CID 174064367) has the molecular formula C20H26N4O3Si and a molecular weight of 398.54 g/mol. Its IUPAC name is 3-amino-N-[2-(4-dimethylsilylanilino)-1-(4-methoxyphenyl)-2-oxoethyl]-3-iminopropanamide.
| Compound Name | 3-amino-N-[2-(4-dimethylsilylanilino)-1-(4-methoxyphenyl)-2-oxoethyl]-3-iminopropanamide |
|---|---|
| PubChem CID | 174064367 |
| Molecular Formula | C20H26N4O3Si |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 3-amino-N-[2-(4-dimethylsilylanilino)-1-(4-methoxyphenyl)-2-oxoethyl]-3-iminopropanamide |
| SMILES | [H]/N=C(\N)CC(=O)NC(C(=O)Nc1ccc([SiH](C)C)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H26N4O3Si/c1-27-15-8-4-13(5-9-15)19(24-18(25)12-17(21)22)20(26)23-14-6-10-16(11-7-14)28(2)3/h4-11,19,28H,12H2,1-3H3,(H3,21,22)(H,23,26)(H,24,25) |
| InChIKey | NRHOLBHTSJTLRS-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 117.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|