C24H29N3O3Si — CID 140781398
1-cyano-N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-N-methylcyclopropane-1-carboxamide (PubChem CID 140781398) has the molecular formula C24H29N3O3Si and a molecular weight of 435.60 g/mol. Its IUPAC name is 1-cyano-N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-N-methylcyclopropane-1-carboxamide.
| Compound Name | 1-cyano-N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-N-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 140781398 |
| Molecular Formula | C24H29N3O3Si |
| Molecular Weight | 435.60 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 1-cyano-N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-N-methylcyclopropane-1-carboxamide |
| SMILES | COc1ccc(C(C(=O)Nc2ccc([Si](C)(C)C)cc2)N(C)C(=O)C2(C#N)CC2)cc1 |
| InChI | InChI=1S/C24H29N3O3Si/c1-27(23(29)24(16-25)14-15-24)21(17-6-10-19(30-2)11-7-17)22(28)26-18-8-12-20(13-9-18)31(3,4)5/h6-13,21H,14-15H2,1-5H3,(H,26,28) |
| InChIKey | MWTOOIIZWLVXCK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.60 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|