C26H29N5O3Si — CID 140781358
N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-N-methyl-2H-pyrazolo[3,4-b]pyridine-3-carboxamide (PubChem CID 140781358) has the molecular formula C26H29N5O3Si and a molecular weight of 487.64 g/mol. Its IUPAC name is N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-N-methyl-2H-pyrazolo[3,4-b]pyridine-3-carboxamide.
| Compound Name | N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-N-methyl-2H-pyrazolo[3,4-b]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 140781358 |
| Molecular Formula | C26H29N5O3Si |
| Molecular Weight | 487.64 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | N-[1-(4-methoxyphenyl)-2-oxo-2-(4-trimethylsilylanilino)ethyl]-N-methyl-2H-pyrazolo[3,4-b]pyridine-3-carboxamide |
| SMILES | COc1ccc(C(C(=O)Nc2ccc([Si](C)(C)C)cc2)N(C)C(=O)c2[nH]nc3ncccc23)cc1 |
| InChI | InChI=1S/C26H29N5O3Si/c1-31(26(33)22-21-7-6-16-27-24(21)30-29-22)23(17-8-12-19(34-2)13-9-17)25(32)28-18-10-14-20(15-11-18)35(3,4)5/h6-16,23H,1-5H3,(H,28,32)(H,27,29,30) |
| InChIKey | GYJVTCZJMNMDNP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.64 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|