C22H30N2O2Si — CID 140781276
2-(4-methoxyphenyl)-2-[methyl(prop-2-enyl)amino]-N-(4-trimethylsilylphenyl)acetamide (PubChem CID 140781276) has the molecular formula C22H30N2O2Si and a molecular weight of 382.58 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-2-[methyl(prop-2-enyl)amino]-N-(4-trimethylsilylphenyl)acetamide.
| Compound Name | 2-(4-methoxyphenyl)-2-[methyl(prop-2-enyl)amino]-N-(4-trimethylsilylphenyl)acetamide |
|---|---|
| PubChem CID | 140781276 |
| Molecular Formula | C22H30N2O2Si |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 2-(4-methoxyphenyl)-2-[methyl(prop-2-enyl)amino]-N-(4-trimethylsilylphenyl)acetamide |
| SMILES | C=CCN(C)C(C(=O)Nc1ccc([Si](C)(C)C)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H30N2O2Si/c1-7-16-24(2)21(17-8-12-19(26-3)13-9-17)22(25)23-18-10-14-20(15-11-18)27(4,5)6/h7-15,21H,1,16H2,2-6H3,(H,23,25) |
| InChIKey | GQIBUQWUZULLMP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|