C23H31FN2O2Si — CID 140781149
N-(3-fluoro-4-trimethylsilylphenyl)-2-[4-(methoxymethyl)phenyl]-2-[methyl(prop-2-enyl)amino]acetamide (PubChem CID 140781149) has the molecular formula C23H31FN2O2Si and a molecular weight of 414.60 g/mol. Its IUPAC name is N-(3-fluoro-4-trimethylsilylphenyl)-2-[4-(methoxymethyl)phenyl]-2-[methyl(prop-2-enyl)amino]acetamide.
| Compound Name | N-(3-fluoro-4-trimethylsilylphenyl)-2-[4-(methoxymethyl)phenyl]-2-[methyl(prop-2-enyl)amino]acetamide |
|---|---|
| PubChem CID | 140781149 |
| Molecular Formula | C23H31FN2O2Si |
| Molecular Weight | 414.60 g/mol |
| Exact Mass | 414.21 |
| IUPAC Name | N-(3-fluoro-4-trimethylsilylphenyl)-2-[4-(methoxymethyl)phenyl]-2-[methyl(prop-2-enyl)amino]acetamide |
| SMILES | C=CCN(C)C(C(=O)Nc1ccc([Si](C)(C)C)c(F)c1)c1ccc(COC)cc1 |
| InChI | InChI=1S/C23H31FN2O2Si/c1-7-14-26(2)22(18-10-8-17(9-11-18)16-28-3)23(27)25-19-12-13-21(20(24)15-19)29(4,5)6/h7-13,15,22H,1,14,16H2,2-6H3,(H,25,27) |
| InChIKey | XHOOGODOPXDBAM-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.60 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|