C26H28FN3O6Si — CID 140781462
(4-nitrophenyl) N-[(1R)-2-(3-fluoro-4-trimethylsilylanilino)-1-[4-(methoxymethyl)phenyl]-2-oxoethyl]carbamate (PubChem CID 140781462) has the molecular formula C26H28FN3O6Si and a molecular weight of 525.61 g/mol. Its IUPAC name is (4-nitrophenyl) N-[(1R)-2-(3-fluoro-4-trimethylsilylanilino)-1-[4-(methoxymethyl)phenyl]-2-oxoethyl]carbamate.
| Compound Name | (4-nitrophenyl) N-[(1R)-2-(3-fluoro-4-trimethylsilylanilino)-1-[4-(methoxymethyl)phenyl]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 140781462 |
| Molecular Formula | C26H28FN3O6Si |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | (4-nitrophenyl) N-[(1R)-2-(3-fluoro-4-trimethylsilylanilino)-1-[4-(methoxymethyl)phenyl]-2-oxoethyl]carbamate |
| SMILES | COCc1ccc([C@@H](NC(=O)Oc2ccc([N+](=O)[O-])cc2)C(=O)Nc2ccc([Si](C)(C)C)c(F)c2)cc1 |
| InChI | InChI=1S/C26H28FN3O6Si/c1-35-16-17-5-7-18(8-6-17)24(29-26(32)36-21-12-10-20(11-13-21)30(33)34)25(31)28-19-9-14-23(22(27)15-19)37(2,3)4/h5-15,24H,16H2,1-4H3,(H,28,31)(H,29,32)/t24-/m1/s1 |
| InChIKey | BPVDWPGSECQOQP-XMMPIXPASA-N |
| XLogP | 4.89 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|