C28H30F2N4O3Si — CID 140781326
N-(2,5-difluoro-4-trimethylsilylphenyl)-2-[(2-indazol-1-ylacetyl)amino]-2-[4-(methoxymethyl)phenyl]acetamide (PubChem CID 140781326) has the molecular formula C28H30F2N4O3Si and a molecular weight of 536.66 g/mol. Its IUPAC name is N-(2,5-difluoro-4-trimethylsilylphenyl)-2-[(2-indazol-1-ylacetyl)amino]-2-[4-(methoxymethyl)phenyl]acetamide.
| Compound Name | N-(2,5-difluoro-4-trimethylsilylphenyl)-2-[(2-indazol-1-ylacetyl)amino]-2-[4-(methoxymethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 140781326 |
| Molecular Formula | C28H30F2N4O3Si |
| Molecular Weight | 536.66 g/mol |
| Exact Mass | 536.21 |
| IUPAC Name | N-(2,5-difluoro-4-trimethylsilylphenyl)-2-[(2-indazol-1-ylacetyl)amino]-2-[4-(methoxymethyl)phenyl]acetamide |
| SMILES | COCc1ccc(C(NC(=O)Cn2ncc3ccccc32)C(=O)Nc2cc(F)c([Si](C)(C)C)cc2F)cc1 |
| InChI | InChI=1S/C28H30F2N4O3Si/c1-37-17-18-9-11-19(12-10-18)27(33-26(35)16-34-24-8-6-5-7-20(24)15-31-34)28(36)32-23-13-22(30)25(14-21(23)29)38(2,3)4/h5-15,27H,16-17H2,1-4H3,(H,32,36)(H,33,35) |
| InChIKey | XJDQELJJEWKINW-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.66 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|