C23H30FNO5SSi — CID 152913842
N-[(1R)-3-(3-fluoro-4-trimethylsilylphenyl)-1-[4-(methoxymethyl)phenyl]-2-oxopropyl]-2-methylsulfonylacetamide (PubChem CID 152913842) has the molecular formula C23H30FNO5SSi and a molecular weight of 479.65 g/mol. Its IUPAC name is N-[(1R)-3-(3-fluoro-4-trimethylsilylphenyl)-1-[4-(methoxymethyl)phenyl]-2-oxopropyl]-2-methylsulfonylacetamide.
| Compound Name | N-[(1R)-3-(3-fluoro-4-trimethylsilylphenyl)-1-[4-(methoxymethyl)phenyl]-2-oxopropyl]-2-methylsulfonylacetamide |
|---|---|
| PubChem CID | 152913842 |
| Molecular Formula | C23H30FNO5SSi |
| Molecular Weight | 479.65 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | N-[(1R)-3-(3-fluoro-4-trimethylsilylphenyl)-1-[4-(methoxymethyl)phenyl]-2-oxopropyl]-2-methylsulfonylacetamide |
| SMILES | COCc1ccc([C@@H](NC(=O)CS(C)(=O)=O)C(=O)Cc2ccc([Si](C)(C)C)c(F)c2)cc1 |
| InChI | InChI=1S/C23H30FNO5SSi/c1-30-14-16-6-9-18(10-7-16)23(25-22(27)15-31(2,28)29)20(26)13-17-8-11-21(19(24)12-17)32(3,4)5/h6-12,23H,13-15H2,1-5H3,(H,25,27)/t23-/m1/s1 |
| InChIKey | UHSOZPFAMZKTHC-HSZRJFAPSA-N |
| XLogP | 2.53 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.65 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|