C23H25ClN2O5Si — CID 159677319
N-[3-(3-chloro-4-trimethylsilylphenyl)-1-(4-methoxyphenyl)-2-oxopropyl]-3-oxo-1,2-oxazole-5-carboxamide (PubChem CID 159677319) has the molecular formula C23H25ClN2O5Si and a molecular weight of 473.00 g/mol. Its IUPAC name is N-[3-(3-chloro-4-trimethylsilylphenyl)-1-(4-methoxyphenyl)-2-oxopropyl]-3-oxo-1,2-oxazole-5-carboxamide.
| Compound Name | N-[3-(3-chloro-4-trimethylsilylphenyl)-1-(4-methoxyphenyl)-2-oxopropyl]-3-oxo-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 159677319 |
| Molecular Formula | C23H25ClN2O5Si |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.12 |
| IUPAC Name | N-[3-(3-chloro-4-trimethylsilylphenyl)-1-(4-methoxyphenyl)-2-oxopropyl]-3-oxo-1,2-oxazole-5-carboxamide |
| SMILES | COc1ccc(C(NC(=O)c2cc(=O)[nH]o2)C(=O)Cc2ccc([Si](C)(C)C)c(Cl)c2)cc1 |
| InChI | InChI=1S/C23H25ClN2O5Si/c1-30-16-8-6-15(7-9-16)22(25-23(29)19-13-21(28)26-31-19)18(27)12-14-5-10-20(17(24)11-14)32(2,3)4/h5-11,13,22H,12H2,1-4H3,(H,25,29)(H,26,28) |
| InChIKey | MUTOGPSSFJEGLQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|