C24H32N2O4Si — CID 157345370
2-(3-hydroxyazetidin-1-yl)-N-[1-(4-methoxyphenyl)-2-oxo-3-(4-trimethylsilylphenyl)propyl]acetamide (PubChem CID 157345370) has the molecular formula C24H32N2O4Si and a molecular weight of 440.62 g/mol. Its IUPAC name is 2-(3-hydroxyazetidin-1-yl)-N-[1-(4-methoxyphenyl)-2-oxo-3-(4-trimethylsilylphenyl)propyl]acetamide.
| Compound Name | 2-(3-hydroxyazetidin-1-yl)-N-[1-(4-methoxyphenyl)-2-oxo-3-(4-trimethylsilylphenyl)propyl]acetamide |
|---|---|
| PubChem CID | 157345370 |
| Molecular Formula | C24H32N2O4Si |
| Molecular Weight | 440.62 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 2-(3-hydroxyazetidin-1-yl)-N-[1-(4-methoxyphenyl)-2-oxo-3-(4-trimethylsilylphenyl)propyl]acetamide |
| SMILES | COc1ccc(C(NC(=O)CN2CC(O)C2)C(=O)Cc2ccc([Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H32N2O4Si/c1-30-20-9-7-18(8-10-20)24(25-23(29)16-26-14-19(27)15-26)22(28)13-17-5-11-21(12-6-17)31(2,3)4/h5-12,19,24,27H,13-16H2,1-4H3,(H,25,29) |
| InChIKey | BGWZYRYREQYFAL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.62 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|