C24H31FN2O4Si — CID 162043493
(3R)-N-[(1R)-3-(3-fluoro-4-trimethylsilylphenyl)-1-(4-methoxyphenyl)-2-oxopropyl]-3-hydroxypyrrolidine-1-carboxamide (PubChem CID 162043493) has the molecular formula C24H31FN2O4Si and a molecular weight of 458.61 g/mol. Its IUPAC name is (3R)-N-[(1R)-3-(3-fluoro-4-trimethylsilylphenyl)-1-(4-methoxyphenyl)-2-oxopropyl]-3-hydroxypyrrolidine-1-carboxamide.
| Compound Name | (3R)-N-[(1R)-3-(3-fluoro-4-trimethylsilylphenyl)-1-(4-methoxyphenyl)-2-oxopropyl]-3-hydroxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 162043493 |
| Molecular Formula | C24H31FN2O4Si |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.20 |
| IUPAC Name | (3R)-N-[(1R)-3-(3-fluoro-4-trimethylsilylphenyl)-1-(4-methoxyphenyl)-2-oxopropyl]-3-hydroxypyrrolidine-1-carboxamide |
| SMILES | COc1ccc([C@@H](NC(=O)N2CC[C@@H](O)C2)C(=O)Cc2ccc([Si](C)(C)C)c(F)c2)cc1 |
| InChI | InChI=1S/C24H31FN2O4Si/c1-31-19-8-6-17(7-9-19)23(26-24(30)27-12-11-18(28)15-27)21(29)14-16-5-10-22(20(25)13-16)32(2,3)4/h5-10,13,18,23,28H,11-12,14-15H2,1-4H3,(H,26,30)/t18-,23-/m1/s1 |
| InChIKey | YXOZIOTVJLZFMH-WZONZLPQSA-N |
| XLogP | 3.01 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|