C23H30FN3O4Si — CID 140781112
N-[2-(3-fluoro-4-trimethylsilylanilino)-1-(4-methoxyphenyl)-2-oxoethyl]-3-hydroxypyrrolidine-1-carboxamide (PubChem CID 140781112) has the molecular formula C23H30FN3O4Si and a molecular weight of 459.59 g/mol. Its IUPAC name is N-[2-(3-fluoro-4-trimethylsilylanilino)-1-(4-methoxyphenyl)-2-oxoethyl]-3-hydroxypyrrolidine-1-carboxamide.
| Compound Name | N-[2-(3-fluoro-4-trimethylsilylanilino)-1-(4-methoxyphenyl)-2-oxoethyl]-3-hydroxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 140781112 |
| Molecular Formula | C23H30FN3O4Si |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | N-[2-(3-fluoro-4-trimethylsilylanilino)-1-(4-methoxyphenyl)-2-oxoethyl]-3-hydroxypyrrolidine-1-carboxamide |
| SMILES | COc1ccc(C(NC(=O)N2CCC(O)C2)C(=O)Nc2ccc([Si](C)(C)C)c(F)c2)cc1 |
| InChI | InChI=1S/C23H30FN3O4Si/c1-31-18-8-5-15(6-9-18)21(26-23(30)27-12-11-17(28)14-27)22(29)25-16-7-10-20(19(24)13-16)32(2,3)4/h5-10,13,17,21,28H,11-12,14H2,1-4H3,(H,25,29)(H,26,30) |
| InChIKey | VQZNRBRSFQDZMG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|