C23H26FN3O5Si — CID 140781121
N-[2-(3-fluoro-4-trimethylsilylanilino)-1-(4-methoxyphenyl)-2-oxoethyl]-N-methyl-3-oxo-1,2-oxazole-5-carboxamide (PubChem CID 140781121) has the molecular formula C23H26FN3O5Si and a molecular weight of 471.56 g/mol. Its IUPAC name is N-[2-(3-fluoro-4-trimethylsilylanilino)-1-(4-methoxyphenyl)-2-oxoethyl]-N-methyl-3-oxo-1,2-oxazole-5-carboxamide.
| Compound Name | N-[2-(3-fluoro-4-trimethylsilylanilino)-1-(4-methoxyphenyl)-2-oxoethyl]-N-methyl-3-oxo-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 140781121 |
| Molecular Formula | C23H26FN3O5Si |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | N-[2-(3-fluoro-4-trimethylsilylanilino)-1-(4-methoxyphenyl)-2-oxoethyl]-N-methyl-3-oxo-1,2-oxazole-5-carboxamide |
| SMILES | COc1ccc(C(C(=O)Nc2ccc([Si](C)(C)C)c(F)c2)N(C)C(=O)c2cc(=O)[nH]o2)cc1 |
| InChI | InChI=1S/C23H26FN3O5Si/c1-27(23(30)18-13-20(28)26-32-18)21(14-6-9-16(31-2)10-7-14)22(29)25-15-8-11-19(17(24)12-15)33(3,4)5/h6-13,21H,1-5H3,(H,25,29)(H,26,28) |
| InChIKey | AKSPQURKNJBORC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|