C24H33N3O4Si — CID 154406830
2-[[2-(3-hydroxypyrrolidin-1-yl)acetyl]amino]-2-(4-methoxyphenyl)-N-(4-trimethylsilylphenyl)acetamide (PubChem CID 154406830) has the molecular formula C24H33N3O4Si and a molecular weight of 455.63 g/mol. Its IUPAC name is 2-[[2-(3-hydroxypyrrolidin-1-yl)acetyl]amino]-2-(4-methoxyphenyl)-N-(4-trimethylsilylphenyl)acetamide.
| Compound Name | 2-[[2-(3-hydroxypyrrolidin-1-yl)acetyl]amino]-2-(4-methoxyphenyl)-N-(4-trimethylsilylphenyl)acetamide |
|---|---|
| PubChem CID | 154406830 |
| Molecular Formula | C24H33N3O4Si |
| Molecular Weight | 455.63 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-[[2-(3-hydroxypyrrolidin-1-yl)acetyl]amino]-2-(4-methoxyphenyl)-N-(4-trimethylsilylphenyl)acetamide |
| SMILES | COc1ccc(C(NC(=O)CN2CCC(O)C2)C(=O)Nc2ccc([Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C24H33N3O4Si/c1-31-20-9-5-17(6-10-20)23(26-22(29)16-27-14-13-19(28)15-27)24(30)25-18-7-11-21(12-8-18)32(2,3)4/h5-12,19,23,28H,13-16H2,1-4H3,(H,25,30)(H,26,29) |
| InChIKey | LAZHGDMZRLOKBP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.63 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|