C25H32N4O3Si — CID 154406816
2-(4-ethoxyphenyl)-2-[[2-(1-methylpyrazol-4-yl)acetyl]amino]-N-(4-trimethylsilylphenyl)acetamide (PubChem CID 154406816) has the molecular formula C25H32N4O3Si and a molecular weight of 464.64 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-2-[[2-(1-methylpyrazol-4-yl)acetyl]amino]-N-(4-trimethylsilylphenyl)acetamide.
| Compound Name | 2-(4-ethoxyphenyl)-2-[[2-(1-methylpyrazol-4-yl)acetyl]amino]-N-(4-trimethylsilylphenyl)acetamide |
|---|---|
| PubChem CID | 154406816 |
| Molecular Formula | C25H32N4O3Si |
| Molecular Weight | 464.64 g/mol |
| Exact Mass | 464.22 |
| IUPAC Name | 2-(4-ethoxyphenyl)-2-[[2-(1-methylpyrazol-4-yl)acetyl]amino]-N-(4-trimethylsilylphenyl)acetamide |
| SMILES | CCOc1ccc(C(NC(=O)Cc2cnn(C)c2)C(=O)Nc2ccc([Si](C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H32N4O3Si/c1-6-32-21-11-7-19(8-12-21)24(28-23(30)15-18-16-26-29(2)17-18)25(31)27-20-9-13-22(14-10-20)33(3,4)5/h7-14,16-17,24H,6,15H2,1-5H3,(H,27,31)(H,28,30) |
| InChIKey | LEIBDMWAGBTINI-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.64 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|