C26H30FN3O4Si — CID 159500159
N-[(1R)-3-(3-fluoro-4-trimethylsilylphenyl)-1-[4-(methoxymethyl)phenyl]-2-oxopropyl]-2-(4-oxopyridazin-1-yl)acetamide (PubChem CID 159500159) has the molecular formula C26H30FN3O4Si and a molecular weight of 495.63 g/mol. Its IUPAC name is N-[(1R)-3-(3-fluoro-4-trimethylsilylphenyl)-1-[4-(methoxymethyl)phenyl]-2-oxopropyl]-2-(4-oxopyridazin-1-yl)acetamide.
| Compound Name | N-[(1R)-3-(3-fluoro-4-trimethylsilylphenyl)-1-[4-(methoxymethyl)phenyl]-2-oxopropyl]-2-(4-oxopyridazin-1-yl)acetamide |
|---|---|
| PubChem CID | 159500159 |
| Molecular Formula | C26H30FN3O4Si |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.20 |
| IUPAC Name | N-[(1R)-3-(3-fluoro-4-trimethylsilylphenyl)-1-[4-(methoxymethyl)phenyl]-2-oxopropyl]-2-(4-oxopyridazin-1-yl)acetamide |
| SMILES | COCc1ccc([C@@H](NC(=O)Cn2ccc(=O)cn2)C(=O)Cc2ccc([Si](C)(C)C)c(F)c2)cc1 |
| InChI | InChI=1S/C26H30FN3O4Si/c1-34-17-18-5-8-20(9-6-18)26(29-25(33)16-30-12-11-21(31)15-28-30)23(32)14-19-7-10-24(22(27)13-19)35(2,3)4/h5-13,15,26H,14,16-17H2,1-4H3,(H,29,33)/t26-/m1/s1 |
| InChIKey | LZHACYHCHWTDEO-AREMUKBSSA-N |
| XLogP | 2.74 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|