C25H33N3O4Si — CID 140781282
N-[2-[4-[ethyl(dimethyl)silyl]anilino]-1-(4-methoxyphenyl)-2-oxoethyl]-2-oxopiperidine-4-carboxamide (PubChem CID 140781282) has the molecular formula C25H33N3O4Si and a molecular weight of 467.64 g/mol. Its IUPAC name is N-[2-[4-[ethyl(dimethyl)silyl]anilino]-1-(4-methoxyphenyl)-2-oxoethyl]-2-oxopiperidine-4-carboxamide.
| Compound Name | N-[2-[4-[ethyl(dimethyl)silyl]anilino]-1-(4-methoxyphenyl)-2-oxoethyl]-2-oxopiperidine-4-carboxamide |
|---|---|
| PubChem CID | 140781282 |
| Molecular Formula | C25H33N3O4Si |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | N-[2-[4-[ethyl(dimethyl)silyl]anilino]-1-(4-methoxyphenyl)-2-oxoethyl]-2-oxopiperidine-4-carboxamide |
| SMILES | CC[Si](C)(C)c1ccc(NC(=O)C(NC(=O)C2CCNC(=O)C2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H33N3O4Si/c1-5-33(3,4)21-12-8-19(9-13-21)27-25(31)23(17-6-10-20(32-2)11-7-17)28-24(30)18-14-15-26-22(29)16-18/h6-13,18,23H,5,14-16H2,1-4H3,(H,26,29)(H,27,31)(H,28,30) |
| InChIKey | BYOWWKMFZKNWPV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|