C32H31IN8O4 — CID 158345919
1-[3-tert-butyl-1-(4-methoxyphenyl)pyrazol-5-yl]-3-[4-[(7-oxo-8H-pteridin-4-yl)oxy]naphthalen-1-yl]urea;deuterio(iodo)methane (PubChem CID 158345919) has the molecular formula C32H31IN8O4 and a molecular weight of 719.56 g/mol. Its IUPAC name is 1-[3-tert-butyl-1-(4-methoxyphenyl)pyrazol-5-yl]-3-[4-[(7-oxo-8H-pteridin-4-yl)oxy]naphthalen-1-yl]urea;deuterio(iodo)methane.
| Compound Name | 1-[3-tert-butyl-1-(4-methoxyphenyl)pyrazol-5-yl]-3-[4-[(7-oxo-8H-pteridin-4-yl)oxy]naphthalen-1-yl]urea;deuterio(iodo)methane |
|---|---|
| PubChem CID | 158345919 |
| Molecular Formula | C32H31IN8O4 |
| Molecular Weight | 719.56 g/mol |
| Exact Mass | 719.16 |
| IUPAC Name | 1-[3-tert-butyl-1-(4-methoxyphenyl)pyrazol-5-yl]-3-[4-[(7-oxo-8H-pteridin-4-yl)oxy]naphthalen-1-yl]urea;deuterio(iodo)methane |
| SMILES | COc1ccc(-n2nc(C(C)(C)C)cc2NC(=O)Nc2ccc(Oc3ncnc4[nH]c(=O)cnc34)c3ccccc23)cc1.[2H]CI |
| InChI | InChI=1S/C31H28N8O4.CH3I/c1-31(2,3)24-15-25(39(38-24)18-9-11-19(42-4)12-10-18)36-30(41)35-22-13-14-23(21-8-6-5-7-20(21)22)43-29-27-28(33-17-34-29)37-26(40)16-32-27;1-2/h5-17H,1-4H3,(H2,35,36,41)(H,33,34,37,40);1H3/i;1D |
| InChIKey | GRSRNDRYZMKYKG-DIYDOPDJSA-N |
| XLogP | 6.85 |
| TPSA | 148.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.56 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|