C33H46Cl2N6O9 — CID 158348095
3-[4-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-3,5-dichlorophenyl]-6-[5-[(4-methyl-2-pyridinyl)amino]pentanoylamino]-5-oxohexanoic acid (PubChem CID 158348095) has the molecular formula C33H46Cl2N6O9 and a molecular weight of 741.67 g/mol. Its IUPAC name is 3-[4-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-3,5-dichlorophenyl]-6-[5-[(4-methyl-2-pyridinyl)amino]pentanoylamino]-5-oxohexanoic acid.
| Compound Name | 3-[4-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-3,5-dichlorophenyl]-6-[5-[(4-methyl-2-pyridinyl)amino]pentanoylamino]-5-oxohexanoic acid |
|---|---|
| PubChem CID | 158348095 |
| Molecular Formula | C33H46Cl2N6O9 |
| Molecular Weight | 741.67 g/mol |
| Exact Mass | 740.27 |
| IUPAC Name | 3-[4-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]-3,5-dichlorophenyl]-6-[5-[(4-methyl-2-pyridinyl)amino]pentanoylamino]-5-oxohexanoic acid |
| SMILES | Cc1ccnc(NCCCCC(=O)NCC(=O)CC(CC(=O)O)c2cc(Cl)c(OCCOCCOCCOCCOCCN=[N+]=[N-])c(Cl)c2)c1 |
| InChI | InChI=1S/C33H46Cl2N6O9/c1-24-5-7-38-30(18-24)37-6-3-2-4-31(43)39-23-27(42)19-25(22-32(44)45)26-20-28(34)33(29(35)21-26)50-17-16-49-15-14-48-13-12-47-11-10-46-9-8-40-41-36/h5,7,18,20-21,25H,2-4,6,8-17,19,22-23H2,1H3,(H,37,38)(H,39,43)(H,44,45) |
| InChIKey | NWRPVZVKPDDICG-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 203.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.67 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|