C31H54N2O9 — CID 158348153
ditert-butyl (2S)-5-hydroxypyrrolidine-1,2-dicarboxylate;ditert-butyl (2S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate (PubChem CID 158348153) has the molecular formula C31H54N2O9 and a molecular weight of 598.78 g/mol. Its IUPAC name is ditert-butyl (2S)-5-hydroxypyrrolidine-1,2-dicarboxylate;ditert-butyl (2S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate.
| Compound Name | ditert-butyl (2S)-5-hydroxypyrrolidine-1,2-dicarboxylate;ditert-butyl (2S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 158348153 |
| Molecular Formula | C31H54N2O9 |
| Molecular Weight | 598.78 g/mol |
| Exact Mass | 598.38 |
| IUPAC Name | ditert-butyl (2S)-5-hydroxypyrrolidine-1,2-dicarboxylate;ditert-butyl (2S)-5-prop-2-enylpyrrolidine-1,2-dicarboxylate |
| SMILES | C=CCC1CC[C@@H](C(=O)OC(C)(C)C)N1C(=O)OC(C)(C)C.CC(C)(C)OC(=O)[C@@H]1CCC(O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29NO4.C14H25NO5/c1-8-9-12-10-11-13(14(19)21-16(2,3)4)18(12)15(20)22-17(5,6)7;1-13(2,3)19-11(17)9-7-8-10(16)15(9)12(18)20-14(4,5)6/h8,12-13H,1,9-11H2,2-7H3;9-10,16H,7-8H2,1-6H3/t12?,13-;9-,10?/m00/s1 |
| InChIKey | GRZIJBZTAHWSNU-MRCWYSNJSA-N |
| XLogP | 5.72 |
| TPSA | 131.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.78 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|