C31H34N2O4 — CID 158348850
N-(1-hydroxy-2,4-dioxohexan-3-yl)-N-methyl-4-[2-[4-(3-pyridin-2-ylpropyl)phenyl]ethynyl]benzamide;methane (PubChem CID 158348850) has the molecular formula C31H34N2O4 and a molecular weight of 498.62 g/mol. Its IUPAC name is N-(1-hydroxy-2,4-dioxohexan-3-yl)-N-methyl-4-[2-[4-(3-pyridin-2-ylpropyl)phenyl]ethynyl]benzamide;methane.
| Compound Name | N-(1-hydroxy-2,4-dioxohexan-3-yl)-N-methyl-4-[2-[4-(3-pyridin-2-ylpropyl)phenyl]ethynyl]benzamide;methane |
|---|---|
| PubChem CID | 158348850 |
| Molecular Formula | C31H34N2O4 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | N-(1-hydroxy-2,4-dioxohexan-3-yl)-N-methyl-4-[2-[4-(3-pyridin-2-ylpropyl)phenyl]ethynyl]benzamide;methane |
| SMILES | C.CCC(=O)C(C(=O)CO)N(C)C(=O)c1ccc(C#Cc2ccc(CCCc3ccccn3)cc2)cc1 |
| InChI | InChI=1S/C30H30N2O4.CH4/c1-3-27(34)29(28(35)21-33)32(2)30(36)25-18-16-24(17-19-25)15-14-23-12-10-22(11-13-23)7-6-9-26-8-4-5-20-31-26;/h4-5,8,10-13,16-20,29,33H,3,6-7,9,21H2,1-2H3;1H4 |
| InChIKey | GSBJWPNCKYIALO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|