C20H19NO — CID 158352147
N-(benzo[b][1]benzoxepin-5-ylmethyl)-N-ethylprop-2-yn-1-amine (PubChem CID 158352147) has the molecular formula C20H19NO and a molecular weight of 289.38 g/mol. Its IUPAC name is N-(benzo[b][1]benzoxepin-5-ylmethyl)-N-ethylprop-2-yn-1-amine.
| Compound Name | N-(benzo[b][1]benzoxepin-5-ylmethyl)-N-ethylprop-2-yn-1-amine |
|---|---|
| PubChem CID | 158352147 |
| Molecular Formula | C20H19NO |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N-(benzo[b][1]benzoxepin-5-ylmethyl)-N-ethylprop-2-yn-1-amine |
| SMILES | C#CCN(CC)CC1=Cc2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C20H19NO/c1-3-13-21(4-2)15-17-14-16-9-5-7-11-19(16)22-20-12-8-6-10-18(17)20/h1,5-12,14H,4,13,15H2,2H3 |
| InChIKey | GSLIVVCJJDQNQJ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|