C14H16ClNOS2 — CID 15835364
4-(4-chlorophenyl)-3-pentoxy-1,3-thiazole-2-thione (PubChem CID 15835364) has the molecular formula C14H16ClNOS2 and a molecular weight of 313.88 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-3-pentoxy-1,3-thiazole-2-thione.
| Compound Name | 4-(4-chlorophenyl)-3-pentoxy-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 15835364 |
| Molecular Formula | C14H16ClNOS2 |
| Molecular Weight | 313.88 g/mol |
| Exact Mass | 313.04 |
| IUPAC Name | 4-(4-chlorophenyl)-3-pentoxy-1,3-thiazole-2-thione |
| SMILES | CCCCCOn1c(-c2ccc(Cl)cc2)csc1=S |
| InChI | InChI=1S/C14H16ClNOS2/c1-2-3-4-9-17-16-13(10-19-14(16)18)11-5-7-12(15)8-6-11/h5-8,10H,2-4,9H2,1H3 |
| InChIKey | RPOXEZXSFBKPBE-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.88 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|