C22H31N3O2 — CID 158357127
methane;2-[4-[2-[3-(morpholin-4-ylmethyl)phenyl]ethyl]phenyl]acetohydrazide (PubChem CID 158357127) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is methane;2-[4-[2-[3-(morpholin-4-ylmethyl)phenyl]ethyl]phenyl]acetohydrazide.
| Compound Name | methane;2-[4-[2-[3-(morpholin-4-ylmethyl)phenyl]ethyl]phenyl]acetohydrazide |
|---|---|
| PubChem CID | 158357127 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | methane;2-[4-[2-[3-(morpholin-4-ylmethyl)phenyl]ethyl]phenyl]acetohydrazide |
| SMILES | C.NNC(=O)Cc1ccc(CCc2cccc(CN3CCOCC3)c2)cc1 |
| InChI | InChI=1S/C21H27N3O2.CH4/c22-23-21(25)15-19-8-5-17(6-9-19)4-7-18-2-1-3-20(14-18)16-24-10-12-26-13-11-24;/h1-3,5-6,8-9,14H,4,7,10-13,15-16,22H2,(H,23,25);1H4 |
| InChIKey | GTAASYVHYGVTLP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|