C46H36F2N6O4 — CID 158362106
4-[1-(3-fluorophenyl)-8-methoxy-5H-pyrido[4,3-b]indol-7-yl]-3,5-dimethyl-1,2-oxazole;4-[1-(4-fluorophenyl)-8-methoxy-5H-pyrido[4,3-b]indol-7-yl]-3,5-dimethyl-1,2-oxazole (PubChem CID 158362106) has the molecular formula C46H36F2N6O4 and a molecular weight of 774.83 g/mol. Its IUPAC name is 4-[1-(3-fluorophenyl)-8-methoxy-5H-pyrido[4,3-b]indol-7-yl]-3,5-dimethyl-1,2-oxazole;4-[1-(4-fluorophenyl)-8-methoxy-5H-pyrido[4,3-b]indol-7-yl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[1-(3-fluorophenyl)-8-methoxy-5H-pyrido[4,3-b]indol-7-yl]-3,5-dimethyl-1,2-oxazole;4-[1-(4-fluorophenyl)-8-methoxy-5H-pyrido[4,3-b]indol-7-yl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 158362106 |
| Molecular Formula | C46H36F2N6O4 |
| Molecular Weight | 774.83 g/mol |
| Exact Mass | 774.28 |
| IUPAC Name | 4-[1-(3-fluorophenyl)-8-methoxy-5H-pyrido[4,3-b]indol-7-yl]-3,5-dimethyl-1,2-oxazole;4-[1-(4-fluorophenyl)-8-methoxy-5H-pyrido[4,3-b]indol-7-yl]-3,5-dimethyl-1,2-oxazole |
| SMILES | COc1cc2c(cc1-c1c(C)noc1C)[nH]c1ccnc(-c3ccc(F)cc3)c12.COc1cc2c(cc1-c1c(C)noc1C)[nH]c1ccnc(-c3cccc(F)c3)c12 |
| InChI | InChI=1S/2C23H18FN3O2/c1-12-21(13(2)29-27-12)17-10-19-16(11-20(17)28-3)22-18(26-19)8-9-25-23(22)14-4-6-15(24)7-5-14;1-12-21(13(2)29-27-12)17-10-19-16(11-20(17)28-3)22-18(26-19)7-8-25-23(22)14-5-4-6-15(24)9-14/h2*4-11,26H,1-3H3 |
| InChIKey | GTPFJSKBRPMRRO-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 127.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.83 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |