C10H10F3N3O — CID 158364444
2,2,2-trifluoro-1-(3-pyrimidin-2-ylpyrrolidin-1-yl)ethanone (PubChem CID 158364444) has the molecular formula C10H10F3N3O and a molecular weight of 245.20 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(3-pyrimidin-2-ylpyrrolidin-1-yl)ethanone.
| Compound Name | 2,2,2-trifluoro-1-(3-pyrimidin-2-ylpyrrolidin-1-yl)ethanone |
|---|---|
| PubChem CID | 158364444 |
| Molecular Formula | C10H10F3N3O |
| Molecular Weight | 245.20 g/mol |
| Exact Mass | 245.08 |
| IUPAC Name | 2,2,2-trifluoro-1-(3-pyrimidin-2-ylpyrrolidin-1-yl)ethanone |
| SMILES | O=C(N1CCC(c2ncccn2)C1)C(F)(F)F |
| InChI | InChI=1S/C10H10F3N3O/c11-10(12,13)9(17)16-5-2-7(6-16)8-14-3-1-4-15-8/h1,3-4,7H,2,5-6H2 |
| InChIKey | MPZHFEXVDGCDHW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.20 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |