C45H34N8O6 — CID 158367966
methyl 4-[[5-(1-oxo-2,3-dihydroisoindol-5-yl)imidazo[1,2-a]pyridin-8-yl]amino]benzoate;4-[[5-(1-oxo-2,3-dihydroisoindol-5-yl)imidazo[1,2-a]pyridin-8-yl]amino]benzoic acid (PubChem CID 158367966) has the molecular formula C45H34N8O6 and a molecular weight of 782.82 g/mol. Its IUPAC name is methyl 4-[[5-(1-oxo-2,3-dihydroisoindol-5-yl)imidazo[1,2-a]pyridin-8-yl]amino]benzoate;4-[[5-(1-oxo-2,3-dihydroisoindol-5-yl)imidazo[1,2-a]pyridin-8-yl]amino]benzoic acid.
| Compound Name | methyl 4-[[5-(1-oxo-2,3-dihydroisoindol-5-yl)imidazo[1,2-a]pyridin-8-yl]amino]benzoate;4-[[5-(1-oxo-2,3-dihydroisoindol-5-yl)imidazo[1,2-a]pyridin-8-yl]amino]benzoic acid |
|---|---|
| PubChem CID | 158367966 |
| Molecular Formula | C45H34N8O6 |
| Molecular Weight | 782.82 g/mol |
| Exact Mass | 782.26 |
| IUPAC Name | methyl 4-[[5-(1-oxo-2,3-dihydroisoindol-5-yl)imidazo[1,2-a]pyridin-8-yl]amino]benzoate;4-[[5-(1-oxo-2,3-dihydroisoindol-5-yl)imidazo[1,2-a]pyridin-8-yl]amino]benzoic acid |
| SMILES | COC(=O)c1ccc(Nc2ccc(-c3ccc4c(c3)CNC4=O)n3ccnc23)cc1.O=C(O)c1ccc(Nc2ccc(-c3ccc4c(c3)CNC4=O)n3ccnc23)cc1 |
| InChI | InChI=1S/C23H18N4O3.C22H16N4O3/c1-30-23(29)14-2-5-17(6-3-14)26-19-8-9-20(27-11-10-24-21(19)27)15-4-7-18-16(12-15)13-25-22(18)28;27-21-17-6-3-14(11-15(17)12-24-21)19-8-7-18(20-23-9-10-26(19)20)25-16-4-1-13(2-5-16)22(28)29/h2-12,26H,13H2,1H3,(H,25,28);1-11,25H,12H2,(H,24,27)(H,28,29) |
| InChIKey | GUGNCWLAXQYFLF-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 180.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.82 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |