C44H51N3O7 — CID 158370966
butan-2-ylbenzene;2-[2-(1,3-dioxoisoindol-2-yl)ethoxycarbonylamino]ethyl 2,2-dimethylbutanoate;10-ethylacridin-9-one (PubChem CID 158370966) has the molecular formula C44H51N3O7 and a molecular weight of 733.91 g/mol. Its IUPAC name is butan-2-ylbenzene;2-[2-(1,3-dioxoisoindol-2-yl)ethoxycarbonylamino]ethyl 2,2-dimethylbutanoate;10-ethylacridin-9-one.
| Compound Name | butan-2-ylbenzene;2-[2-(1,3-dioxoisoindol-2-yl)ethoxycarbonylamino]ethyl 2,2-dimethylbutanoate;10-ethylacridin-9-one |
|---|---|
| PubChem CID | 158370966 |
| Molecular Formula | C44H51N3O7 |
| Molecular Weight | 733.91 g/mol |
| Exact Mass | 733.37 |
| IUPAC Name | butan-2-ylbenzene;2-[2-(1,3-dioxoisoindol-2-yl)ethoxycarbonylamino]ethyl 2,2-dimethylbutanoate;10-ethylacridin-9-one |
| SMILES | CCC(C)(C)C(=O)OCCNC(=O)OCCN1C(=O)c2ccccc2C1=O.CCC(C)c1ccccc1.CCn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C19H24N2O6.C15H13NO.C10H14/c1-4-19(2,3)17(24)26-11-9-20-18(25)27-12-10-21-15(22)13-7-5-6-8-14(13)16(21)23;1-2-16-13-9-5-3-7-11(13)15(17)12-8-4-6-10-14(12)16;1-3-9(2)10-7-5-4-6-8-10/h5-8H,4,9-12H2,1-3H3,(H,20,25);3-10H,2H2,1H3;4-9H,3H2,1-2H3 |
| InChIKey | GUPKMOAOFSQMGE-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.91 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|