C27H37NO8 — CID 171578910
3-O-butyl 1-O-[2-(1,3-dioxoisoindol-2-yl)ethyl] 5-O-methyl 1,1,5-trimethylhexane-1,3,5-tricarboxylate (PubChem CID 171578910) has the molecular formula C27H37NO8 and a molecular weight of 503.59 g/mol. Its IUPAC name is 3-O-butyl 1-O-[2-(1,3-dioxoisoindol-2-yl)ethyl] 5-O-methyl 1,1,5-trimethylhexane-1,3,5-tricarboxylate.
| Compound Name | 3-O-butyl 1-O-[2-(1,3-dioxoisoindol-2-yl)ethyl] 5-O-methyl 1,1,5-trimethylhexane-1,3,5-tricarboxylate |
|---|---|
| PubChem CID | 171578910 |
| Molecular Formula | C27H37NO8 |
| Molecular Weight | 503.59 g/mol |
| Exact Mass | 503.25 |
| IUPAC Name | 3-O-butyl 1-O-[2-(1,3-dioxoisoindol-2-yl)ethyl] 5-O-methyl 1,1,5-trimethylhexane-1,3,5-tricarboxylate |
| SMILES | CCCCOC(=O)C(CC(C)(C)C(=O)OC)CC(C)(C)C(=O)OCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C27H37NO8/c1-7-8-14-35-23(31)18(16-26(2,3)24(32)34-6)17-27(4,5)25(33)36-15-13-28-21(29)19-11-9-10-12-20(19)22(28)30/h9-12,18H,7-8,13-17H2,1-6H3 |
| InChIKey | KHWRUWUWWLSOSK-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.59 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|