C13H19FIN4O4P2+ — CID 158373288
imino-iodo-phosphanylphosphanium;methyl 4-[(2-fluoro-3-nitrophenyl)methyl]piperazine-1-carboxylate (PubChem CID 158373288) has the molecular formula C13H19FIN4O4P2+ and a molecular weight of 503.17 g/mol. Its IUPAC name is imino-iodo-phosphanylphosphanium;methyl 4-[(2-fluoro-3-nitrophenyl)methyl]piperazine-1-carboxylate.
| Compound Name | imino-iodo-phosphanylphosphanium;methyl 4-[(2-fluoro-3-nitrophenyl)methyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 158373288 |
| Molecular Formula | C13H19FIN4O4P2+ |
| Molecular Weight | 503.17 g/mol |
| Exact Mass | 502.99 |
| IUPAC Name | imino-iodo-phosphanylphosphanium;methyl 4-[(2-fluoro-3-nitrophenyl)methyl]piperazine-1-carboxylate |
| SMILES | COC(=O)N1CCN(Cc2cccc([N+](=O)[O-])c2F)CC1.[H]/N=[P+](/P)I |
| InChI | InChI=1S/C13H16FN3O4.H3INP2/c1-21-13(18)16-7-5-15(6-8-16)9-10-3-2-4-11(12(10)14)17(19)20;1-4(2)3/h2-4H,5-9H2,1H3;2H,3H2/q;+1 |
| InChIKey | ZHKHVTJCYAKFGT-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.17 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|