C33H40ClN5O5 — CID 158374754
4-[4-[[(3S)-1-butyl-3-[(1-oxidopyridin-1-ium-2-yl)methyl]-2,5-dioxo-1,4,9-triazaspiro[5.5]undecan-9-yl]methyl]phenoxy]-N-methylbenzamide;hydrochloride (PubChem CID 158374754) has the molecular formula C33H40ClN5O5 and a molecular weight of 622.17 g/mol. Its IUPAC name is 4-[4-[[(3S)-1-butyl-3-[(1-oxidopyridin-1-ium-2-yl)methyl]-2,5-dioxo-1,4,9-triazaspiro[5.5]undecan-9-yl]methyl]phenoxy]-N-methylbenzamide;hydrochloride.
| Compound Name | 4-[4-[[(3S)-1-butyl-3-[(1-oxidopyridin-1-ium-2-yl)methyl]-2,5-dioxo-1,4,9-triazaspiro[5.5]undecan-9-yl]methyl]phenoxy]-N-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 158374754 |
| Molecular Formula | C33H40ClN5O5 |
| Molecular Weight | 622.17 g/mol |
| Exact Mass | 621.27 |
| IUPAC Name | 4-[4-[[(3S)-1-butyl-3-[(1-oxidopyridin-1-ium-2-yl)methyl]-2,5-dioxo-1,4,9-triazaspiro[5.5]undecan-9-yl]methyl]phenoxy]-N-methylbenzamide;hydrochloride |
| SMILES | CCCCN1C(=O)[C@H](Cc2cccc[n+]2[O-])NC(=O)C12CCN(Cc1ccc(Oc3ccc(C(=O)NC)cc3)cc1)CC2.Cl |
| InChI | InChI=1S/C33H39N5O5.ClH/c1-3-4-18-37-31(40)29(22-26-7-5-6-19-38(26)42)35-32(41)33(37)16-20-36(21-17-33)23-24-8-12-27(13-9-24)43-28-14-10-25(11-15-28)30(39)34-2;/h5-15,19,29H,3-4,16-18,20-23H2,1-2H3,(H,34,39)(H,35,41);1H/t29-;/m0./s1 |
| InChIKey | XOAQZQLSXKWJHP-JMAPEOGHSA-N |
| XLogP | 3.60 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.17 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|