C31H42N4O5 — CID 58635406
(3R)-1-butyl-3-[(R)-cyclohexyl(hydroxy)methyl]-9-[[4-(1-oxidopyridin-1-ium-3-yl)oxyphenyl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione (PubChem CID 58635406) has the molecular formula C31H42N4O5 and a molecular weight of 550.70 g/mol. Its IUPAC name is (3R)-1-butyl-3-[(R)-cyclohexyl(hydroxy)methyl]-9-[[4-(1-oxidopyridin-1-ium-3-yl)oxyphenyl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione.
| Compound Name | (3R)-1-butyl-3-[(R)-cyclohexyl(hydroxy)methyl]-9-[[4-(1-oxidopyridin-1-ium-3-yl)oxyphenyl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 58635406 |
| Molecular Formula | C31H42N4O5 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.32 |
| IUPAC Name | (3R)-1-butyl-3-[(R)-cyclohexyl(hydroxy)methyl]-9-[[4-(1-oxidopyridin-1-ium-3-yl)oxyphenyl]methyl]-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
| SMILES | CCCCN1C(=O)[C@@H]([C@H](O)C2CCCCC2)NC(=O)C12CCN(Cc1ccc(Oc3ccc[n+]([O-])c3)cc1)CC2 |
| InChI | InChI=1S/C31H42N4O5/c1-2-3-18-35-29(37)27(28(36)24-8-5-4-6-9-24)32-30(38)31(35)15-19-33(20-16-31)21-23-11-13-25(14-12-23)40-26-10-7-17-34(39)22-26/h7,10-14,17,22,24,27-28,36H,2-6,8-9,15-16,18-21H2,1H3,(H,32,38)/t27-,28-/m1/s1 |
| InChIKey | XUUFDBVFLZBUED-VSGBNLITSA-N |
| XLogP | 3.52 |
| TPSA | 109.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|