C33H44IN3O4 — CID 71095302
3-[(R)-cyclohexyl(hydroxy)methyl]-9-[[4-(4-iodophenoxy)phenyl]methyl]-1-pentyl-1,4,9-triazaspiro[5.5]undecane-2,5-dione (PubChem CID 71095302) has the molecular formula C33H44IN3O4 and a molecular weight of 673.64 g/mol. Its IUPAC name is 3-[(R)-cyclohexyl(hydroxy)methyl]-9-[[4-(4-iodophenoxy)phenyl]methyl]-1-pentyl-1,4,9-triazaspiro[5.5]undecane-2,5-dione.
| Compound Name | 3-[(R)-cyclohexyl(hydroxy)methyl]-9-[[4-(4-iodophenoxy)phenyl]methyl]-1-pentyl-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
|---|---|
| PubChem CID | 71095302 |
| Molecular Formula | C33H44IN3O4 |
| Molecular Weight | 673.64 g/mol |
| Exact Mass | 673.24 |
| IUPAC Name | 3-[(R)-cyclohexyl(hydroxy)methyl]-9-[[4-(4-iodophenoxy)phenyl]methyl]-1-pentyl-1,4,9-triazaspiro[5.5]undecane-2,5-dione |
| SMILES | CCCCCN1C(=O)C([C@H](O)C2CCCCC2)NC(=O)C12CCN(Cc1ccc(Oc3ccc(I)cc3)cc1)CC2 |
| InChI | InChI=1S/C33H44IN3O4/c1-2-3-7-20-37-31(39)29(30(38)25-8-5-4-6-9-25)35-32(40)33(37)18-21-36(22-19-33)23-24-10-14-27(15-11-24)41-28-16-12-26(34)13-17-28/h10-17,25,29-30,38H,2-9,18-23H2,1H3,(H,35,40)/t29?,30-/m1/s1 |
| InChIKey | SJFYUUVAYBOSNA-BDCODIICSA-N |
| XLogP | 5.88 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|