C56H57F3O9S — CID 158378104
9-hexyl-9-pentylfluorene-3-carboxylic acid;methyl 9H-fluorene-3-carboxylate;methyl 3-(2-methylphenyl)-4-(trifluoromethylsulfonyloxy)benzoate (PubChem CID 158378104) has the molecular formula C56H57F3O9S and a molecular weight of 963.12 g/mol. Its IUPAC name is 9-hexyl-9-pentylfluorene-3-carboxylic acid;methyl 9H-fluorene-3-carboxylate;methyl 3-(2-methylphenyl)-4-(trifluoromethylsulfonyloxy)benzoate.
| Compound Name | 9-hexyl-9-pentylfluorene-3-carboxylic acid;methyl 9H-fluorene-3-carboxylate;methyl 3-(2-methylphenyl)-4-(trifluoromethylsulfonyloxy)benzoate |
|---|---|
| PubChem CID | 158378104 |
| Molecular Formula | C56H57F3O9S |
| Molecular Weight | 963.12 g/mol |
| Exact Mass | 962.37 |
| IUPAC Name | 9-hexyl-9-pentylfluorene-3-carboxylic acid;methyl 9H-fluorene-3-carboxylate;methyl 3-(2-methylphenyl)-4-(trifluoromethylsulfonyloxy)benzoate |
| SMILES | CCCCCCC1(CCCCC)c2ccccc2-c2cc(C(=O)O)ccc21.COC(=O)c1ccc(OS(=O)(=O)C(F)(F)F)c(-c2ccccc2C)c1.COC(=O)c1ccc2c(c1)-c1ccccc1C2 |
| InChI | InChI=1S/C25H32O2.C16H13F3O5S.C15H12O2/c1-3-5-7-11-17-25(16-10-6-4-2)22-13-9-8-12-20(22)21-18-19(24(26)27)14-15-23(21)25;1-10-5-3-4-6-12(10)13-9-11(15(20)23-2)7-8-14(13)24-25(21,22)16(17,18)19;1-17-15(16)12-7-6-11-8-10-4-2-3-5-13(10)14(11)9-12/h8-9,12-15,18H,3-7,10-11,16-17H2,1-2H3,(H,26,27);3-9H,1-2H3;2-7,9H,8H2,1H3 |
| InChIKey | GVLIUVUZHOMDTA-UHFFFAOYSA-N |
| XLogP | 13.92 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.12 |
| LogP ≤ 5 | 13.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|