C38H42BrF2IN6O2 — CID 158378549
4-bromo-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-3-fluorobenzamide;N-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluorophenyl]-4-iodobenzamide (PubChem CID 158378549) has the molecular formula C38H42BrF2IN6O2 and a molecular weight of 859.60 g/mol. Its IUPAC name is 4-bromo-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-3-fluorobenzamide;N-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluorophenyl]-4-iodobenzamide.
| Compound Name | 4-bromo-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-3-fluorobenzamide;N-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluorophenyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 158378549 |
| Molecular Formula | C38H42BrF2IN6O2 |
| Molecular Weight | 859.60 g/mol |
| Exact Mass | 858.16 |
| IUPAC Name | 4-bromo-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-3-fluorobenzamide;N-[4-[(3R)-3-(dimethylamino)pyrrolidin-1-yl]-3-fluorophenyl]-4-iodobenzamide |
| SMILES | CN(C)C1CCN(c2ccc(NC(=O)c3ccc(Br)c(F)c3)cc2)C1.CN(C)[C@@H]1CCN(c2ccc(NC(=O)c3ccc(I)cc3)cc2F)C1 |
| InChI | InChI=1S/C19H21BrFN3O.C19H21FIN3O/c1-23(2)16-9-10-24(12-16)15-6-4-14(5-7-15)22-19(25)13-3-8-17(20)18(21)11-13;1-23(2)16-9-10-24(12-16)18-8-7-15(11-17(18)20)22-19(25)13-3-5-14(21)6-4-13/h2*3-8,11,16H,9-10,12H2,1-2H3,(H,22,25)/t;16-/m.1/s1 |
| InChIKey | GVMSHEUNYCDVOW-QSNIKYNRSA-N |
| XLogP | 7.80 |
| TPSA | 71.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 859.60 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|