C43H32F3N3 — CID 158379892
2,6-bis(3,6-dimethylcarbazol-9-yl)-3-[2-methyl-4-(trifluoromethyl)phenyl]benzonitrile (PubChem CID 158379892) has the molecular formula C43H32F3N3 and a molecular weight of 647.74 g/mol. Its IUPAC name is 2,6-bis(3,6-dimethylcarbazol-9-yl)-3-[2-methyl-4-(trifluoromethyl)phenyl]benzonitrile.
| Compound Name | 2,6-bis(3,6-dimethylcarbazol-9-yl)-3-[2-methyl-4-(trifluoromethyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 158379892 |
| Molecular Formula | C43H32F3N3 |
| Molecular Weight | 647.74 g/mol |
| Exact Mass | 647.25 |
| IUPAC Name | 2,6-bis(3,6-dimethylcarbazol-9-yl)-3-[2-methyl-4-(trifluoromethyl)phenyl]benzonitrile |
| SMILES | Cc1ccc2c(c1)c1cc(C)ccc1n2-c1ccc(-c2ccc(C(F)(F)F)cc2C)c(-n2c3ccc(C)cc3c3cc(C)ccc32)c1C#N |
| InChI | InChI=1S/C43H32F3N3/c1-24-6-13-37-32(18-24)33-19-25(2)7-14-38(33)48(37)41-17-12-31(30-11-10-29(22-28(30)5)43(44,45)46)42(36(41)23-47)49-39-15-8-26(3)20-34(39)35-21-27(4)9-16-40(35)49/h6-22H,1-5H3 |
| InChIKey | GVQTZSKRFCIZPN-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 33.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.74 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |