C26H32O2 — CID 158380489
cyclopenta-1,3-diene;4-cyclopent-2-en-1-yl-2,6-dimethylphenol;2,6-dimethylphenol (PubChem CID 158380489) has the molecular formula C26H32O2 and a molecular weight of 376.54 g/mol. Its IUPAC name is cyclopenta-1,3-diene;4-cyclopent-2-en-1-yl-2,6-dimethylphenol;2,6-dimethylphenol.
| Compound Name | cyclopenta-1,3-diene;4-cyclopent-2-en-1-yl-2,6-dimethylphenol;2,6-dimethylphenol |
|---|---|
| PubChem CID | 158380489 |
| Molecular Formula | C26H32O2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | cyclopenta-1,3-diene;4-cyclopent-2-en-1-yl-2,6-dimethylphenol;2,6-dimethylphenol |
| SMILES | C1=CCC=C1.Cc1cc(C2C=CCC2)cc(C)c1O.Cc1cccc(C)c1O |
| InChI | InChI=1S/C13H16O.C8H10O.C5H6/c1-9-7-12(8-10(2)13(9)14)11-5-3-4-6-11;1-6-4-3-5-7(2)8(6)9;1-2-4-5-3-1/h3,5,7-8,11,14H,4,6H2,1-2H3;3-5,9H,1-2H3;1-4H,5H2 |
| InChIKey | GVSOPMUOEDOVAV-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|