C34H27BrN4O4S2 — CID 158381377
1-(benzenesulfonyl)-3-bromo-5-isocyano-2,6-dimethylindole;1-(benzenesulfonyl)-5-isocyano-2,6-dimethylindole (PubChem CID 158381377) has the molecular formula C34H27BrN4O4S2 and a molecular weight of 699.65 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-bromo-5-isocyano-2,6-dimethylindole;1-(benzenesulfonyl)-5-isocyano-2,6-dimethylindole.
| Compound Name | 1-(benzenesulfonyl)-3-bromo-5-isocyano-2,6-dimethylindole;1-(benzenesulfonyl)-5-isocyano-2,6-dimethylindole |
|---|---|
| PubChem CID | 158381377 |
| Molecular Formula | C34H27BrN4O4S2 |
| Molecular Weight | 699.65 g/mol |
| Exact Mass | 698.07 |
| IUPAC Name | 1-(benzenesulfonyl)-3-bromo-5-isocyano-2,6-dimethylindole;1-(benzenesulfonyl)-5-isocyano-2,6-dimethylindole |
| SMILES | [C-]#[N+]c1cc2c(Br)c(C)n(S(=O)(=O)c3ccccc3)c2cc1C.[C-]#[N+]c1cc2cc(C)n(S(=O)(=O)c3ccccc3)c2cc1C |
| InChI | InChI=1S/C17H13BrN2O2S.C17H14N2O2S/c1-11-9-16-14(10-15(11)19-3)17(18)12(2)20(16)23(21,22)13-7-5-4-6-8-13;1-12-9-17-14(11-16(12)18-3)10-13(2)19(17)22(20,21)15-7-5-4-6-8-15/h4-10H,1-2H3;4-11H,1-2H3 |
| InChIKey | GVVFTVGCMWWRRD-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 86.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.65 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|