C32H46F5NO2S — CID 15838153
(7R,8R,9S,13S,17S)-13-methyl-7-[5-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]amino]pentyl]-6,7,8,9,11,12,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 15838153) has the molecular formula C32H46F5NO2S and a molecular weight of 603.78 g/mol. Its IUPAC name is (7R,8R,9S,13S,17S)-13-methyl-7-[5-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]amino]pentyl]-6,7,8,9,11,12,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (7R,8R,9S,13S,17S)-13-methyl-7-[5-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]amino]pentyl]-6,7,8,9,11,12,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 15838153 |
| Molecular Formula | C32H46F5NO2S |
| Molecular Weight | 603.78 g/mol |
| Exact Mass | 603.32 |
| IUPAC Name | (7R,8R,9S,13S,17S)-13-methyl-7-[5-[methyl-[3-(4,4,5,5,5-pentafluoropentylsulfanyl)propyl]amino]pentyl]-6,7,8,9,11,12,16,17-octahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CN(CCCCC[C@@H]1Cc2cc(O)ccc2[C@H]2CC[C@@]3(C)C(=CC[C@@H]3O)[C@H]12)CCCSCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C32H46F5NO2S/c1-30-15-13-26-25-10-9-24(39)21-23(25)20-22(29(26)27(30)11-12-28(30)40)8-4-3-5-16-38(2)17-7-19-41-18-6-14-31(33,34)32(35,36)37/h9-11,21-22,26,28-29,39-40H,3-8,12-20H2,1-2H3/t22-,26-,28+,29-,30+/m1/s1 |
| InChIKey | KAZVMXITFLUZLJ-UMSPOXMLSA-N |
| XLogP | 8.35 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.78 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|