C15H18Cl2N2O4 — CID 158383588
(2R)-2-[2-[3-(2,5-dichlorophenyl)-3-oxopropanoyl]hydrazinyl]-4-methylpentanoic acid (PubChem CID 158383588) has the molecular formula C15H18Cl2N2O4 and a molecular weight of 361.23 g/mol. Its IUPAC name is (2R)-2-[2-[3-(2,5-dichlorophenyl)-3-oxopropanoyl]hydrazinyl]-4-methylpentanoic acid.
| Compound Name | (2R)-2-[2-[3-(2,5-dichlorophenyl)-3-oxopropanoyl]hydrazinyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 158383588 |
| Molecular Formula | C15H18Cl2N2O4 |
| Molecular Weight | 361.23 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | (2R)-2-[2-[3-(2,5-dichlorophenyl)-3-oxopropanoyl]hydrazinyl]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@@H](NNC(=O)CC(=O)c1cc(Cl)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C15H18Cl2N2O4/c1-8(2)5-12(15(22)23)18-19-14(21)7-13(20)10-6-9(16)3-4-11(10)17/h3-4,6,8,12,18H,5,7H2,1-2H3,(H,19,21)(H,22,23)/t12-/m1/s1 |
| InChIKey | NBIQLTQADGTASE-GFCCVEGCSA-N |
| XLogP | 2.69 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|