C16H19NO5 — CID 158385385
oxaldehydic acid;(1S,5R)-2-[(1R)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one (PubChem CID 158385385) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is oxaldehydic acid;(1S,5R)-2-[(1R)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one.
| Compound Name | oxaldehydic acid;(1S,5R)-2-[(1R)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one |
|---|---|
| PubChem CID | 158385385 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | oxaldehydic acid;(1S,5R)-2-[(1R)-1-phenylethyl]-6-oxa-2-azabicyclo[3.2.1]octan-7-one |
| SMILES | C[C@H](c1ccccc1)N1CC[C@@H]2C[C@H]1C(=O)O2.O=CC(=O)O |
| InChI | InChI=1S/C14H17NO2.C2H2O3/c1-10(11-5-3-2-4-6-11)15-8-7-12-9-13(15)14(16)17-12;3-1-2(4)5/h2-6,10,12-13H,7-9H2,1H3;1H,(H,4,5)/t10-,12-,13+;/m1./s1 |
| InChIKey | GWHOBJZERCYCMH-OLNVGVAHSA-N |
| XLogP | 1.41 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|