C55H46N6O3 — CID 158385479
2-(3-phenylmethoxyphenyl)-1H-pyrrolo[2,3-b]pyridine;2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridine;3-(1H-pyrrolo[2,3-b]pyridin-2-yl)phenol (PubChem CID 158385479) has the molecular formula C55H46N6O3 and a molecular weight of 839.01 g/mol. Its IUPAC name is 2-(3-phenylmethoxyphenyl)-1H-pyrrolo[2,3-b]pyridine;2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridine;3-(1H-pyrrolo[2,3-b]pyridin-2-yl)phenol.
| Compound Name | 2-(3-phenylmethoxyphenyl)-1H-pyrrolo[2,3-b]pyridine;2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridine;3-(1H-pyrrolo[2,3-b]pyridin-2-yl)phenol |
|---|---|
| PubChem CID | 158385479 |
| Molecular Formula | C55H46N6O3 |
| Molecular Weight | 839.01 g/mol |
| Exact Mass | 838.36 |
| IUPAC Name | 2-(3-phenylmethoxyphenyl)-1H-pyrrolo[2,3-b]pyridine;2-[3-(3-phenylpropoxy)phenyl]-1H-pyrrolo[2,3-b]pyridine;3-(1H-pyrrolo[2,3-b]pyridin-2-yl)phenol |
| SMILES | Oc1cccc(-c2cc3cccnc3[nH]2)c1.c1ccc(CCCOc2cccc(-c3cc4cccnc4[nH]3)c2)cc1.c1ccc(COc2cccc(-c3cc4cccnc4[nH]3)c2)cc1 |
| InChI | InChI=1S/C22H20N2O.C20H16N2O.C13H10N2O/c1-2-7-17(8-3-1)9-6-14-25-20-12-4-10-18(15-20)21-16-19-11-5-13-23-22(19)24-21;1-2-6-15(7-3-1)14-23-18-10-4-8-16(12-18)19-13-17-9-5-11-21-20(17)22-19;16-11-5-1-3-9(7-11)12-8-10-4-2-6-14-13(10)15-12/h1-5,7-8,10-13,15-16H,6,9,14H2,(H,23,24);1-13H,14H2,(H,21,22);1-8,16H,(H,14,15) |
| InChIKey | GWHWFFWARIYTAL-UHFFFAOYSA-N |
| XLogP | 12.99 |
| TPSA | 124.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.01 |
| LogP ≤ 5 | 12.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|