C34H46BrIN6O4 — CID 158387816
5-bromo-1H-indazole;tert-butyl 4-(1H-indazol-5-yl)piperidine-1-carboxylate;tert-butyl 4-iodopiperidine-1-carboxylate (PubChem CID 158387816) has the molecular formula C34H46BrIN6O4 and a molecular weight of 809.59 g/mol. Its IUPAC name is 5-bromo-1H-indazole;tert-butyl 4-(1H-indazol-5-yl)piperidine-1-carboxylate;tert-butyl 4-iodopiperidine-1-carboxylate.
| Compound Name | 5-bromo-1H-indazole;tert-butyl 4-(1H-indazol-5-yl)piperidine-1-carboxylate;tert-butyl 4-iodopiperidine-1-carboxylate |
|---|---|
| PubChem CID | 158387816 |
| Molecular Formula | C34H46BrIN6O4 |
| Molecular Weight | 809.59 g/mol |
| Exact Mass | 808.18 |
| IUPAC Name | 5-bromo-1H-indazole;tert-butyl 4-(1H-indazol-5-yl)piperidine-1-carboxylate;tert-butyl 4-iodopiperidine-1-carboxylate |
| SMILES | Brc1ccc2[nH]ncc2c1.CC(C)(C)OC(=O)N1CCC(I)CC1.CC(C)(C)OC(=O)N1CCC(c2ccc3[nH]ncc3c2)CC1 |
| InChI | InChI=1S/C17H23N3O2.C10H18INO2.C7H5BrN2/c1-17(2,3)22-16(21)20-8-6-12(7-9-20)13-4-5-15-14(10-13)11-18-19-15;1-10(2,3)14-9(13)12-6-4-8(11)5-7-12;8-6-1-2-7-5(3-6)4-9-10-7/h4-5,10-12H,6-9H2,1-3H3,(H,18,19);8H,4-7H2,1-3H3;1-4H,(H,9,10) |
| InChIKey | GWOPZMBEOWGMMJ-UHFFFAOYSA-N |
| XLogP | 8.82 |
| TPSA | 116.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 809.59 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|