C17H26BNO4S — CID 158391911
[(2R)-1-cyclopropyl-5-(methanesulfonamido)-4-oxo-6-phenylhexan-2-yl]-methylborinic acid (PubChem CID 158391911) has the molecular formula C17H26BNO4S and a molecular weight of 351.28 g/mol. Its IUPAC name is [(2R)-1-cyclopropyl-5-(methanesulfonamido)-4-oxo-6-phenylhexan-2-yl]-methylborinic acid.
| Compound Name | [(2R)-1-cyclopropyl-5-(methanesulfonamido)-4-oxo-6-phenylhexan-2-yl]-methylborinic acid |
|---|---|
| PubChem CID | 158391911 |
| Molecular Formula | C17H26BNO4S |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | [(2R)-1-cyclopropyl-5-(methanesulfonamido)-4-oxo-6-phenylhexan-2-yl]-methylborinic acid |
| SMILES | CB(O)[C@@H](CC(=O)C(Cc1ccccc1)NS(C)(=O)=O)CC1CC1 |
| InChI | InChI=1S/C17H26BNO4S/c1-18(21)15(10-14-8-9-14)12-17(20)16(19-24(2,22)23)11-13-6-4-3-5-7-13/h3-7,14-16,19,21H,8-12H2,1-2H3/t15-,16?/m1/s1 |
| InChIKey | HXURDMIBRSHQLK-AAFJCEBUSA-N |
| XLogP | 1.89 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|