About (2S)-3-(4-chlorophenyl)-2-methyl-N'-methylsulfonylpropanimidamide
(2S)-3-(4-chlorophenyl)-2-methyl-N'-methylsulfonylpropanimidamide (PubChem CID 158392731) has the molecular formula C11H15ClN2O2S
and a molecular weight of 274.77 g/mol. Its IUPAC name is (2S)-3-(4-chlorophenyl)-2-methyl-N'-methylsulfonylpropanimidamide.
Molecular Properties
| Compound Name | (2S)-3-(4-chlorophenyl)-2-methyl-N'-methylsulfonylpropanimidamide |
| PubChem CID | 158392731 |
| Molecular Formula | C11H15ClN2O2S |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | (2S)-3-(4-chlorophenyl)-2-methyl-N'-methylsulfonylpropanimidamide |
| SMILES | C[C@@H](Cc1ccc(Cl)cc1)C(N)=NS(C)(=O)=O |
| InChI | InChI=1S/C11H15ClN2O2S/c1-8(11(13)14-17(2,15)16)7-9-3-5-10(12)6-4-9/h3-6,8H,7H2,1-2H3,(H2,13,14)/t8-/m0/s1 |
| InChIKey | GXDYTKZHPKBYJP-QMMMGPOBSA-N |
| XLogP | 1.84 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (2S)-3-(4-chlorophenyl)-2-methyl-N'-methylsulfonylpropanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-3-(4-chlorophenyl)-2-methyl-N'-methylsulfonylpropanimidamide?
The IUPAC name of (2S)-3-(4-chlorophenyl)-2-methyl-N'-methylsulfonylpropanimidamide (CID 158392731) is (2S)-3-(4-chlorophenyl)-2-methyl-N'-methylsulfonylpropanimidamide.
What is the SMILES notation for (2S)-3-(4-chlorophenyl)-2-methyl-N'-methylsulfonylpropanimidamide?
The canonical SMILES for (2S)-3-(4-chlorophenyl)-2-methyl-N'-methylsulfonylpropanimidamide is C[C@@H](Cc1ccc(Cl)cc1)C(N)=NS(C)(=O)=O.
What is the InChIKey of (2S)-3-(4-chlorophenyl)-2-methyl-N'-methylsulfonylpropanimidamide?
The InChIKey is GXDYTKZHPKBYJP-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H15ClN2O2S/c1-8(11(13)14-17(2,15)16)7-9-3-5-10(12)6-4-9/h3-6,8H,7H2,1-2H3,(H2,13,14)/t8-/m0/s1.
What are the key properties of (2S)-3-(4-chlorophenyl)-2-methyl-N'-methylsulfonylpropanimidamide?
(2S)-3-(4-chlorophenyl)-2-methyl-N'-methylsulfonylpropanimidamide has a molecular weight of 274.77 g/mol, XLogP of 1.84, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-3-(4-chlorophenyl)-2-methyl-N'-methylsulfonylpropanimidamide is sourced from PubChem (CID 158392731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).