C17H24N2OS2 — CID 158397778
3-(2-isocyanatobutyl)thiophene;1-thiophen-3-ylbutan-2-amine (PubChem CID 158397778) has the molecular formula C17H24N2OS2 and a molecular weight of 336.53 g/mol. Its IUPAC name is 3-(2-isocyanatobutyl)thiophene;1-thiophen-3-ylbutan-2-amine.
| Compound Name | 3-(2-isocyanatobutyl)thiophene;1-thiophen-3-ylbutan-2-amine |
|---|---|
| PubChem CID | 158397778 |
| Molecular Formula | C17H24N2OS2 |
| Molecular Weight | 336.53 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 3-(2-isocyanatobutyl)thiophene;1-thiophen-3-ylbutan-2-amine |
| SMILES | CCC(Cc1ccsc1)N=C=O.CCC(N)Cc1ccsc1 |
| InChI | InChI=1S/C9H11NOS.C8H13NS/c1-2-9(10-7-11)5-8-3-4-12-6-8;1-2-8(9)5-7-3-4-10-6-7/h3-4,6,9H,2,5H2,1H3;3-4,6,8H,2,5,9H2,1H3 |
| InChIKey | GXSNYEXQVDMGDA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.53 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|