C46H50O4 — CID 158398469
3-tert-butyl-4-[1-(2-tert-butyl-4-hydroxyphenyl)propyl]phenol;4-[(4-hydroxyphenyl)-naphthalen-1-ylmethyl]phenol (PubChem CID 158398469) has the molecular formula C46H50O4 and a molecular weight of 666.90 g/mol. Its IUPAC name is 3-tert-butyl-4-[1-(2-tert-butyl-4-hydroxyphenyl)propyl]phenol;4-[(4-hydroxyphenyl)-naphthalen-1-ylmethyl]phenol.
| Compound Name | 3-tert-butyl-4-[1-(2-tert-butyl-4-hydroxyphenyl)propyl]phenol;4-[(4-hydroxyphenyl)-naphthalen-1-ylmethyl]phenol |
|---|---|
| PubChem CID | 158398469 |
| Molecular Formula | C46H50O4 |
| Molecular Weight | 666.90 g/mol |
| Exact Mass | 666.37 |
| IUPAC Name | 3-tert-butyl-4-[1-(2-tert-butyl-4-hydroxyphenyl)propyl]phenol;4-[(4-hydroxyphenyl)-naphthalen-1-ylmethyl]phenol |
| SMILES | CCC(c1ccc(O)cc1C(C)(C)C)c1ccc(O)cc1C(C)(C)C.Oc1ccc(C(c2ccc(O)cc2)c2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C23H18O2.C23H32O2/c24-19-12-8-17(9-13-19)23(18-10-14-20(25)15-11-18)22-7-3-5-16-4-1-2-6-21(16)22;1-8-17(18-11-9-15(24)13-20(18)22(2,3)4)19-12-10-16(25)14-21(19)23(5,6)7/h1-15,23-25H;9-14,17,24-25H,8H2,1-7H3 |
| InChIKey | GXURRDFHQSTPLB-UHFFFAOYSA-N |
| XLogP | 11.67 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.90 |
| LogP ≤ 5 | 11.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|