C18H23N3O — CID 158402730
3-benzyl-7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine (PubChem CID 158402730) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 3-benzyl-7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine.
| Compound Name | 3-benzyl-7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 158402730 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 3-benzyl-7-(oxan-4-yl)-6,8-dihydro-5H-imidazo[1,5-a]pyrazine |
| SMILES | c1ccc(Cc2ncc3n2CCN(C2CCOCC2)C3)cc1 |
| InChI | InChI=1S/C18H23N3O/c1-2-4-15(5-3-1)12-18-19-13-17-14-20(8-9-21(17)18)16-6-10-22-11-7-16/h1-5,13,16H,6-12,14H2 |
| InChIKey | GYHMSVHJBKOMHX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |