C41H46FN7 — CID 159055377
7-benzyl-N-methyl-N-phenyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-amine;deuterio(fluoro)methane;3,7-dibenzyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine (PubChem CID 159055377) has the molecular formula C41H46FN7 and a molecular weight of 656.87 g/mol. Its IUPAC name is 7-benzyl-N-methyl-N-phenyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-amine;deuterio(fluoro)methane;3,7-dibenzyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine.
| Compound Name | 7-benzyl-N-methyl-N-phenyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-amine;deuterio(fluoro)methane;3,7-dibenzyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine |
|---|---|
| PubChem CID | 159055377 |
| Molecular Formula | C41H46FN7 |
| Molecular Weight | 656.87 g/mol |
| Exact Mass | 656.39 |
| IUPAC Name | 7-benzyl-N-methyl-N-phenyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-amine;deuterio(fluoro)methane;3,7-dibenzyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazine |
| SMILES | CN(c1ccccc1)c1ncc2n1CCN(Cc1ccccc1)C2.[2H]CF.c1ccc(Cc2ncc3n2CCN(Cc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C20H22N4.C20H21N3.CH3F/c1-22(18-10-6-3-7-11-18)20-21-14-19-16-23(12-13-24(19)20)15-17-8-4-2-5-9-17;1-3-7-17(8-4-1)13-20-21-14-19-16-22(11-12-23(19)20)15-18-9-5-2-6-10-18;1-2/h2-11,14H,12-13,15-16H2,1H3;1-10,14H,11-13,15-16H2;1H3/i;;1D |
| InChIKey | JXUCOXOJYJGOEP-PRQZKWGPSA-N |
| XLogP | 7.74 |
| TPSA | 45.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.87 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |