C9H8ClNO2 — CID 15840729
6-(chloromethyl)-3-methyl-1,3-benzoxazol-2-one (PubChem CID 15840729) has the molecular formula C9H8ClNO2 and a molecular weight of 197.62 g/mol. Its IUPAC name is 6-(chloromethyl)-3-methyl-1,3-benzoxazol-2-one.
| Compound Name | 6-(chloromethyl)-3-methyl-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 15840729 |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.62 g/mol |
| Exact Mass | 197.02 |
| IUPAC Name | 6-(chloromethyl)-3-methyl-1,3-benzoxazol-2-one |
| SMILES | Cn1c(=O)oc2cc(CCl)ccc21 |
| InChI | InChI=1S/C9H8ClNO2/c1-11-7-3-2-6(5-10)4-8(7)13-9(11)12/h2-4H,5H2,1H3 |
| InChIKey | RPTVGPBAVWDIEM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.62 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|